C22H25ClFN3O2 — CID 130285889
N-[1-[4-[(3-chlorobenzoyl)amino]butyl]cyclopentyl]-5-fluoropyridine-2-carboxamide (PubChem CID 130285889) has the molecular formula C22H25ClFN3O2 and a molecular weight of 417.91 g/mol. Its IUPAC name is N-[1-[4-[(3-chlorobenzoyl)amino]butyl]cyclopentyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[1-[4-[(3-chlorobenzoyl)amino]butyl]cyclopentyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 130285889 |
| Molecular Formula | C22H25ClFN3O2 |
| Molecular Weight | 417.91 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-[1-[4-[(3-chlorobenzoyl)amino]butyl]cyclopentyl]-5-fluoropyridine-2-carboxamide |
| SMILES | O=C(NCCCCC1(NC(=O)c2ccc(F)cn2)CCCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H25ClFN3O2/c23-17-7-5-6-16(14-17)20(28)25-13-4-3-12-22(10-1-2-11-22)27-21(29)19-9-8-18(24)15-26-19/h5-9,14-15H,1-4,10-13H2,(H,25,28)(H,27,29) |
| InChIKey | XSDJHQJERAIQBB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.91 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|