C20H28N4O4S2 — CID 130287558
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-1,3-oxathiolane-2-carboxylate (PubChem CID 130287558) has the molecular formula C20H28N4O4S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-1,3-oxathiolane-2-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-1,3-oxathiolane-2-carboxylate |
|---|---|
| PubChem CID | 130287558 |
| Molecular Formula | C20H28N4O4S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-(5-amino-7-methyl-2-oxo-[1,3]thiazolo[4,5-d]pyrimidin-3-yl)-1,3-oxathiolane-2-carboxylate |
| SMILES | Cc1nc(N)nc2c1sc(=O)n2[C@H]1CS[C@@H](C(=O)O[C@@H]2C[C@H](C)CCC2C(C)C)O1 |
| InChI | InChI=1S/C20H28N4O4S2/c1-9(2)12-6-5-10(3)7-13(12)27-17(25)18-28-14(8-29-18)24-16-15(30-20(24)26)11(4)22-19(21)23-16/h9-10,12-14,18H,5-8H2,1-4H3,(H2,21,22,23)/t10-,12?,13-,14-,18+/m1/s1 |
| InChIKey | MZPHGBSZDQAJBU-MAUCYVCGSA-N |
| XLogP | 3.34 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |