C14H23ClO3S — CID 163203374
[(1R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-chloro-1,3-oxathiolane-2-carboxylate (PubChem CID 163203374) has the molecular formula C14H23ClO3S and a molecular weight of 306.86 g/mol. Its IUPAC name is [(1R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-chloro-1,3-oxathiolane-2-carboxylate.
| Compound Name | [(1R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-chloro-1,3-oxathiolane-2-carboxylate |
|---|---|
| PubChem CID | 163203374 |
| Molecular Formula | C14H23ClO3S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [(1R)-5-methyl-2-propan-2-ylcyclohexyl] (2S,5R)-5-chloro-1,3-oxathiolane-2-carboxylate |
| SMILES | CC1CCC(C(C)C)[C@H](OC(=O)[C@H]2O[C@H](Cl)CS2)C1 |
| InChI | InChI=1S/C14H23ClO3S/c1-8(2)10-5-4-9(3)6-11(10)17-13(16)14-18-12(15)7-19-14/h8-12,14H,4-7H2,1-3H3/t9?,10?,11-,12+,14+/m1/s1 |
| InChIKey | UAPSOKRVEPQQFQ-HSAVVBHYSA-N |
| XLogP | 3.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|