C14H25ClO3S — CID 58516705
(5S)-5-chloro-2-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]peroxymethyl]-1,3-oxathiolane (PubChem CID 58516705) has the molecular formula C14H25ClO3S and a molecular weight of 308.87 g/mol. Its IUPAC name is (5S)-5-chloro-2-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]peroxymethyl]-1,3-oxathiolane.
| Compound Name | (5S)-5-chloro-2-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]peroxymethyl]-1,3-oxathiolane |
|---|---|
| PubChem CID | 58516705 |
| Molecular Formula | C14H25ClO3S |
| Molecular Weight | 308.87 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (5S)-5-chloro-2-[[(2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]peroxymethyl]-1,3-oxathiolane |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)CC1OOCC1O[C@@H](Cl)CS1 |
| InChI | InChI=1S/C14H25ClO3S/c1-9(2)11-5-4-10(3)6-12(11)18-16-7-14-17-13(15)8-19-14/h9-14H,4-8H2,1-3H3/t10-,11+,12?,13-,14?/m1/s1 |
| InChIKey | TUQFSNAGXOHYNC-NFMDPKQHSA-N |
| XLogP | 4.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.87 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|