C39H43N3O5S — CID 46848726
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,5S)-5-[2-oxo-4-(3,3,3-triphenylpropanoylamino)pyrimidin-1-yl]-1,3-oxathiolane-2-carboxylate (PubChem CID 46848726) has the molecular formula C39H43N3O5S and a molecular weight of 665.86 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,5S)-5-[2-oxo-4-(3,3,3-triphenylpropanoylamino)pyrimidin-1-yl]-1,3-oxathiolane-2-carboxylate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,5S)-5-[2-oxo-4-(3,3,3-triphenylpropanoylamino)pyrimidin-1-yl]-1,3-oxathiolane-2-carboxylate |
|---|---|
| PubChem CID | 46848726 |
| Molecular Formula | C39H43N3O5S |
| Molecular Weight | 665.86 g/mol |
| Exact Mass | 665.29 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] (2R,5S)-5-[2-oxo-4-(3,3,3-triphenylpropanoylamino)pyrimidin-1-yl]-1,3-oxathiolane-2-carboxylate |
| SMILES | CC(C)C1CC[C@@H](C)C[C@H]1OC(=O)[C@@H]1O[C@H](n2ccc(NC(=O)CC(c3ccccc3)(c3ccccc3)c3ccccc3)nc2=O)CS1 |
| InChI | InChI=1S/C39H43N3O5S/c1-26(2)31-20-19-27(3)23-32(31)46-36(44)37-47-35(25-48-37)42-22-21-33(41-38(42)45)40-34(43)24-39(28-13-7-4-8-14-28,29-15-9-5-10-16-29)30-17-11-6-12-18-30/h4-18,21-22,26-27,31-32,35,37H,19-20,23-25H2,1-3H3,(H,40,41,43,45)/t27-,31?,32-,35+,37-/m1/s1 |
| InChIKey | DGUMAKAAQPJZAT-KOWMHZRBSA-N |
| XLogP | 7.20 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.86 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|