C9H11ClF3NO2 — CID 130287985
1-(3,3,3-trifluoropropanoyl)piperidine-4-carbonyl chloride (PubChem CID 130287985) has the molecular formula C9H11ClF3NO2 and a molecular weight of 257.64 g/mol. Its IUPAC name is 1-(3,3,3-trifluoropropanoyl)piperidine-4-carbonyl chloride.
| Compound Name | 1-(3,3,3-trifluoropropanoyl)piperidine-4-carbonyl chloride |
|---|---|
| PubChem CID | 130287985 |
| Molecular Formula | C9H11ClF3NO2 |
| Molecular Weight | 257.64 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-(3,3,3-trifluoropropanoyl)piperidine-4-carbonyl chloride |
| SMILES | O=C(Cl)C1CCN(C(=O)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C9H11ClF3NO2/c10-8(16)6-1-3-14(4-2-6)7(15)5-9(11,12)13/h6H,1-5H2 |
| InChIKey | PYVSYCVAQNIHCQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.64 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|