C24H36N5O8P — CID 130288074
methyl 2-[(Z)-4-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]but-2-enoxy]-2-dimethylphosphorylacetate (PubChem CID 130288074) has the molecular formula C24H36N5O8P and a molecular weight of 553.55 g/mol. Its IUPAC name is methyl 2-[(Z)-4-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]but-2-enoxy]-2-dimethylphosphorylacetate.
| Compound Name | methyl 2-[(Z)-4-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]but-2-enoxy]-2-dimethylphosphorylacetate |
|---|---|
| PubChem CID | 130288074 |
| Molecular Formula | C24H36N5O8P |
| Molecular Weight | 553.55 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | methyl 2-[(Z)-4-[6-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]purin-9-yl]but-2-enoxy]-2-dimethylphosphorylacetate |
| SMILES | COC(=O)C(OC/C=C\Cn1cnc2c(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)ncnc21)P(C)(C)=O |
| InChI | InChI=1S/C24H36N5O8P/c1-23(2,3)36-21(31)29(22(32)37-24(4,5)6)18-16-17(25-14-26-18)28(15-27-16)12-10-11-13-35-20(19(30)34-7)38(8,9)33/h10-11,14-15,20H,12-13H2,1-9H3/b11-10- |
| InChIKey | WUAYGAXXXMNXOR-KHPPLWFESA-N |
| XLogP | 4.20 |
| TPSA | 152.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.55 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|