About ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate
ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate (PubChem CID 130293096) has the molecular formula C14H19F3O2S
and a molecular weight of 308.37 g/mol. Its IUPAC name is ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate.
Molecular Properties
| Compound Name | ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate |
| PubChem CID | 130293096 |
| Molecular Formula | C14H19F3O2S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate |
| SMILES | CCOC(=O)[C@@H](C)S(C)(C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3O2S/c1-5-19-13(18)10(2)20(3,4)12-8-6-11(7-9-12)14(15,16)17/h6-10H,5H2,1-4H3/t10-/m1/s1 |
| InChIKey | FRUNEBJYFGKHHC-SNVBAGLBSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate?
The IUPAC name of ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate (CID 130293096) is ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate.
What is the SMILES notation for ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate?
The canonical SMILES for ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate is CCOC(=O)[C@@H](C)S(C)(C)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate?
The InChIKey is FRUNEBJYFGKHHC-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H19F3O2S/c1-5-19-13(18)10(2)20(3,4)12-8-6-11(7-9-12)14(15,16)17/h6-10H,5H2,1-4H3/t10-/m1/s1.
What are the key properties of ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate?
ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate has a molecular weight of 308.37 g/mol, XLogP of 4.08, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2R)-2-[dimethyl-[4-(trifluoromethyl)phenyl]-λ4-sulfanyl]propanoate is sourced from PubChem (CID 130293096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).