C18H32N4O9S — CID 130294828
(3S)-3-[[2-amino-3-[3-(2-propoxyethoxy)propanoylamino]propanoyl]amino]-4-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-4-oxobutanoic acid (PubChem CID 130294828) has the molecular formula C18H32N4O9S and a molecular weight of 480.54 g/mol. Its IUPAC name is (3S)-3-[[2-amino-3-[3-(2-propoxyethoxy)propanoylamino]propanoyl]amino]-4-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[2-amino-3-[3-(2-propoxyethoxy)propanoylamino]propanoyl]amino]-4-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 130294828 |
| Molecular Formula | C18H32N4O9S |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (3S)-3-[[2-amino-3-[3-(2-propoxyethoxy)propanoylamino]propanoyl]amino]-4-[[(1R)-1-carboxy-2-sulfanylethyl]amino]-4-oxobutanoic acid |
| SMILES | CCCOCCOCCC(=O)NCC(N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C18H32N4O9S/c1-2-4-30-6-7-31-5-3-14(23)20-9-11(19)16(26)21-12(8-15(24)25)17(27)22-13(10-32)18(28)29/h11-13,32H,2-10,19H2,1H3,(H,20,23)(H,21,26)(H,22,27)(H,24,25)(H,28,29)/t11?,12-,13-/m0/s1 |
| InChIKey | CWTIQUQSXIEPLL-SPOOISQMSA-N |
| XLogP | -2.28 |
| TPSA | 206.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|