C21H32N6O14S — CID 90824849
2-[[4-[[2-amino-3-[[3-carboxy-1-[(1-carboxy-2-sulfanylethyl)amino]-1-oxopropan-2-yl]amino]-3-oxopropyl]amino]-1-carboxy-4-oxobutyl]carbamoylamino]pentanedioic acid (PubChem CID 90824849) has the molecular formula C21H32N6O14S and a molecular weight of 624.58 g/mol. Its IUPAC name is 2-[[4-[[2-amino-3-[[3-carboxy-1-[(1-carboxy-2-sulfanylethyl)amino]-1-oxopropan-2-yl]amino]-3-oxopropyl]amino]-1-carboxy-4-oxobutyl]carbamoylamino]pentanedioic acid.
| Compound Name | 2-[[4-[[2-amino-3-[[3-carboxy-1-[(1-carboxy-2-sulfanylethyl)amino]-1-oxopropan-2-yl]amino]-3-oxopropyl]amino]-1-carboxy-4-oxobutyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 90824849 |
| Molecular Formula | C21H32N6O14S |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | 2-[[4-[[2-amino-3-[[3-carboxy-1-[(1-carboxy-2-sulfanylethyl)amino]-1-oxopropan-2-yl]amino]-3-oxopropyl]amino]-1-carboxy-4-oxobutyl]carbamoylamino]pentanedioic acid |
| SMILES | NC(CNC(=O)CCC(NC(=O)NC(CCC(=O)O)C(=O)O)C(=O)O)C(=O)NC(CC(=O)O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C21H32N6O14S/c22-8(16(33)24-11(5-15(31)32)17(34)25-12(7-42)20(39)40)6-23-13(28)3-1-9(18(35)36)26-21(41)27-10(19(37)38)2-4-14(29)30/h8-12,42H,1-7,22H2,(H,23,28)(H,24,33)(H,25,34)(H,29,30)(H,31,32)(H,35,36)(H,37,38)(H,39,40)(H2,26,27,41) |
| InChIKey | JGIYKUIELHOUKG-UHFFFAOYSA-N |
| XLogP | -4.26 |
| TPSA | 340.95 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | -4.26 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|