C20H30N6O13S — CID 123949238
2-[[4-[[2-amino-3-[[3-carboxy-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-3-oxopropyl]amino]-1-carboxy-4-oxobutyl]carbamothioylamino]pentanedioic acid (PubChem CID 123949238) has the molecular formula C20H30N6O13S and a molecular weight of 594.56 g/mol. Its IUPAC name is 2-[[4-[[2-amino-3-[[3-carboxy-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-3-oxopropyl]amino]-1-carboxy-4-oxobutyl]carbamothioylamino]pentanedioic acid.
| Compound Name | 2-[[4-[[2-amino-3-[[3-carboxy-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-3-oxopropyl]amino]-1-carboxy-4-oxobutyl]carbamothioylamino]pentanedioic acid |
|---|---|
| PubChem CID | 123949238 |
| Molecular Formula | C20H30N6O13S |
| Molecular Weight | 594.56 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | 2-[[4-[[2-amino-3-[[3-carboxy-1-(carboxymethylamino)-1-oxopropan-2-yl]amino]-3-oxopropyl]amino]-1-carboxy-4-oxobutyl]carbamothioylamino]pentanedioic acid |
| SMILES | NC(CNC(=O)CCC(NC(=S)NC(CCC(=O)O)C(=O)O)C(=O)O)C(=O)NC(CC(=O)O)C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H30N6O13S/c21-8(16(34)24-11(5-14(30)31)17(35)23-7-15(32)33)6-22-12(27)3-1-9(18(36)37)25-20(40)26-10(19(38)39)2-4-13(28)29/h8-11H,1-7,21H2,(H,22,27)(H,23,35)(H,24,34)(H,28,29)(H,30,31)(H,32,33)(H,36,37)(H,38,39)(H2,25,26,40) |
| InChIKey | GMCULQHTUQRKSO-UHFFFAOYSA-N |
| XLogP | -4.39 |
| TPSA | 323.88 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.56 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|