C24H29ClN2O5 — CID 130297891
ethyl 2-chloro-6-[(2,4-dimethoxyphenyl)methyl]-8-ethyl-5,5-dimethyl-7-oxo-1,6-naphthyridine-8-carboxylate (PubChem CID 130297891) has the molecular formula C24H29ClN2O5 and a molecular weight of 460.96 g/mol. Its IUPAC name is ethyl 2-chloro-6-[(2,4-dimethoxyphenyl)methyl]-8-ethyl-5,5-dimethyl-7-oxo-1,6-naphthyridine-8-carboxylate.
| Compound Name | ethyl 2-chloro-6-[(2,4-dimethoxyphenyl)methyl]-8-ethyl-5,5-dimethyl-7-oxo-1,6-naphthyridine-8-carboxylate |
|---|---|
| PubChem CID | 130297891 |
| Molecular Formula | C24H29ClN2O5 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | ethyl 2-chloro-6-[(2,4-dimethoxyphenyl)methyl]-8-ethyl-5,5-dimethyl-7-oxo-1,6-naphthyridine-8-carboxylate |
| SMILES | CCOC(=O)C1(CC)C(=O)N(Cc2ccc(OC)cc2OC)C(C)(C)c2ccc(Cl)nc21 |
| InChI | InChI=1S/C24H29ClN2O5/c1-7-24(22(29)32-8-2)20-17(11-12-19(25)26-20)23(3,4)27(21(24)28)14-15-9-10-16(30-5)13-18(15)31-6/h9-13H,7-8,14H2,1-6H3 |
| InChIKey | UUJZWGQOEKBMCN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|