C25H34FN4O9PS — CID 130297949
methyl 3-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]oxy-2,2-dimethylpropanoate (PubChem CID 130297949) has the molecular formula C25H34FN4O9PS and a molecular weight of 616.61 g/mol. Its IUPAC name is methyl 3-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]oxy-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]oxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 130297949 |
| Molecular Formula | C25H34FN4O9PS |
| Molecular Weight | 616.61 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | methyl 3-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy-[[(2S)-1-oxo-1-phenylmethoxypropan-2-yl]amino]phosphoryl]oxy-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)COP(=O)(N[C@@H](C)C(=O)OCc1ccccc1)OC[C@H]1S[C@@H](n2ccc(N)nc2=O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C25H34FN4O9PS/c1-15(22(32)37-12-16-8-6-5-7-9-16)29-40(35,39-14-25(2,3)23(33)36-4)38-13-17-20(31)19(26)21(41-17)30-11-10-18(27)28-24(30)34/h5-11,15,17,19-21,31H,12-14H2,1-4H3,(H,29,35)(H2,27,28,34)/t15-,17+,19-,20+,21+,40?/m0/s1 |
| InChIKey | VLOGQEVJLDCAEH-KPNYQCBESA-N |
| XLogP | 2.20 |
| TPSA | 181.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.61 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|