C20H26FN4O9PS — CID 130297976
[2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy]phenyl]peroxy-N-(1-methoxy-2-methyl-1-oxopropan-2-yl)phosphonamidic acid (PubChem CID 130297976) has the molecular formula C20H26FN4O9PS and a molecular weight of 548.49 g/mol. Its IUPAC name is [2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy]phenyl]peroxy-N-(1-methoxy-2-methyl-1-oxopropan-2-yl)phosphonamidic acid.
| Compound Name | [2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy]phenyl]peroxy-N-(1-methoxy-2-methyl-1-oxopropan-2-yl)phosphonamidic acid |
|---|---|
| PubChem CID | 130297976 |
| Molecular Formula | C20H26FN4O9PS |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | [2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy]phenyl]peroxy-N-(1-methoxy-2-methyl-1-oxopropan-2-yl)phosphonamidic acid |
| SMILES | COC(=O)C(C)(C)NP(=O)(O)OOc1ccccc1OC[C@H]1S[C@@H](n2ccc(N)nc2=O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C20H26FN4O9PS/c1-20(2,18(27)31-3)24-35(29,30)34-33-12-7-5-4-6-11(12)32-10-13-16(26)15(21)17(36-13)25-9-8-14(22)23-19(25)28/h4-9,13,15-17,26H,10H2,1-3H3,(H2,22,23,28)(H2,24,29,30)/t13-,15+,16-,17-/m1/s1 |
| InChIKey | XUTGFCSGOJZKAZ-XLNGHYISSA-N |
| XLogP | 1.17 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|