C21H28FN4O9PS — CID 130298102
[2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy]phenyl]peroxy-N-[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]phosphonamidic acid (PubChem CID 130298102) has the molecular formula C21H28FN4O9PS and a molecular weight of 562.51 g/mol. Its IUPAC name is [2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy]phenyl]peroxy-N-[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]phosphonamidic acid.
| Compound Name | [2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy]phenyl]peroxy-N-[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]phosphonamidic acid |
|---|---|
| PubChem CID | 130298102 |
| Molecular Formula | C21H28FN4O9PS |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | [2-[[(2R,3S,4S,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-4-fluoro-3-hydroxythiolan-2-yl]methoxy]phenyl]peroxy-N-[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl]phosphonamidic acid |
| SMILES | CC(C)OC(=O)[C@H](C)NP(=O)(O)OOc1ccccc1OC[C@H]1S[C@@H](n2ccc(N)nc2=O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C21H28FN4O9PS/c1-11(2)33-20(28)12(3)25-36(30,31)35-34-14-7-5-4-6-13(14)32-10-15-18(27)17(22)19(37-15)26-9-8-16(23)24-21(26)29/h4-9,11-12,15,17-19,27H,10H2,1-3H3,(H2,23,24,29)(H2,25,30,31)/t12-,15+,17-,18+,19+/m0/s1 |
| InChIKey | PMJSPLJEGXCXPD-DZCVVJTQSA-N |
| XLogP | 1.56 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|