C21H21BrF3NO3S2 — CID 130298453
ethyl 2-[4-bromo-2-[(Z)-tert-butylsulfinyliminomethyl]-6-(trifluoromethyl)phenyl]sulfanylbenzoate (PubChem CID 130298453) has the molecular formula C21H21BrF3NO3S2 and a molecular weight of 536.44 g/mol. Its IUPAC name is ethyl 2-[4-bromo-2-[(Z)-tert-butylsulfinyliminomethyl]-6-(trifluoromethyl)phenyl]sulfanylbenzoate.
| Compound Name | ethyl 2-[4-bromo-2-[(Z)-tert-butylsulfinyliminomethyl]-6-(trifluoromethyl)phenyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 130298453 |
| Molecular Formula | C21H21BrF3NO3S2 |
| Molecular Weight | 536.44 g/mol |
| Exact Mass | 535.01 |
| IUPAC Name | ethyl 2-[4-bromo-2-[(Z)-tert-butylsulfinyliminomethyl]-6-(trifluoromethyl)phenyl]sulfanylbenzoate |
| SMILES | CCOC(=O)c1ccccc1Sc1c(/C=N\S(=O)C(C)(C)C)cc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C21H21BrF3NO3S2/c1-5-29-19(27)15-8-6-7-9-17(15)30-18-13(12-26-31(28)20(2,3)4)10-14(22)11-16(18)21(23,24)25/h6-12H,5H2,1-4H3/b26-12- |
| InChIKey | RFCNDBIQPAMLKC-ZRGSRPPYSA-N |
| XLogP | 6.68 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.44 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|