C19H20Cl2N2O3S2 — CID 130298461
ethyl 2-[2-[(Z)-tert-butylsulfinyliminomethyl]-4,6-dichlorophenyl]sulfanylpyridine-3-carboxylate (PubChem CID 130298461) has the molecular formula C19H20Cl2N2O3S2 and a molecular weight of 459.42 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-tert-butylsulfinyliminomethyl]-4,6-dichlorophenyl]sulfanylpyridine-3-carboxylate.
| Compound Name | ethyl 2-[2-[(Z)-tert-butylsulfinyliminomethyl]-4,6-dichlorophenyl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 130298461 |
| Molecular Formula | C19H20Cl2N2O3S2 |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | ethyl 2-[2-[(Z)-tert-butylsulfinyliminomethyl]-4,6-dichlorophenyl]sulfanylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cccnc1Sc1c(Cl)cc(Cl)cc1/C=N\S(=O)C(C)(C)C |
| InChI | InChI=1S/C19H20Cl2N2O3S2/c1-5-26-18(24)14-7-6-8-22-17(14)27-16-12(9-13(20)10-15(16)21)11-23-28(25)19(2,3)4/h6-11H,5H2,1-4H3/b23-11- |
| InChIKey | XANOAWJBKCYKTR-KSEXSDGBSA-N |
| XLogP | 5.60 |
| TPSA | 68.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|