About ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid
ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid (PubChem CID 158492755) has the molecular formula C30H32O4S2
and a molecular weight of 520.72 g/mol. Its IUPAC name is ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid.
Molecular Properties
| Compound Name | ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid |
| PubChem CID | 158492755 |
| Molecular Formula | C30H32O4S2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid |
| SMILES | C.C.CCOC(=O)c1ccccc1Sc1ccccc1.O=C(O)c1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C15H14O2S.C13H10O2S.2CH4/c1-2-17-15(16)13-10-6-7-11-14(13)18-12-8-4-3-5-9-12;14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10;;/h3-11H,2H2,1H3;1-9H,(H,14,15);2*1H4 |
| InChIKey | HIXBWIWIPLRZPS-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid?
The IUPAC name of ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid (CID 158492755) is ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid.
What is the SMILES notation for ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid?
The canonical SMILES for ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid is C.C.CCOC(=O)c1ccccc1Sc1ccccc1.O=C(O)c1ccccc1Sc1ccccc1.
What is the InChIKey of ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid?
The InChIKey is HIXBWIWIPLRZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O2S.C13H10O2S.2CH4/c1-2-17-15(16)13-10-6-7-11-14(13)18-12-8-4-3-5-9-12;14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10;;/h3-11H,2H2,1H3;1-9H,(H,14,15);2*1H4.
What are the key properties of ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid?
ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid has a molecular weight of 520.72 g/mol, XLogP of 8.82, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-phenylsulfanylbenzoate;methane;2-phenylsulfanylbenzoic acid is sourced from PubChem (CID 158492755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).