C22H20O3S2 — CID 102405086
ethyl 2-hydroxy-4-methyl-3,5-bis(phenylsulfanyl)benzoate (PubChem CID 102405086) has the molecular formula C22H20O3S2 and a molecular weight of 396.53 g/mol. Its IUPAC name is ethyl 2-hydroxy-4-methyl-3,5-bis(phenylsulfanyl)benzoate.
| Compound Name | ethyl 2-hydroxy-4-methyl-3,5-bis(phenylsulfanyl)benzoate |
|---|---|
| PubChem CID | 102405086 |
| Molecular Formula | C22H20O3S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | ethyl 2-hydroxy-4-methyl-3,5-bis(phenylsulfanyl)benzoate |
| SMILES | CCOC(=O)c1cc(Sc2ccccc2)c(C)c(Sc2ccccc2)c1O |
| InChI | InChI=1S/C22H20O3S2/c1-3-25-22(24)18-14-19(26-16-10-6-4-7-11-16)15(2)21(20(18)23)27-17-12-8-5-9-13-17/h4-14,23H,3H2,1-2H3 |
| InChIKey | JJUDTVPCYJRMGU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |