6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid

C7H6N2O2 — CID 130299224

IUPAC6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid
SMILESO=C(O)c1cc2n(n1)CC=C2
InChIInChI=1S/C7H6N2O2/c10-7(11)6-4-5-2-1-3-9(5)8-6/h1-2,4H,3H2,(H,10,11)
InChIKeyIATCEXDXRBSKDF-UHFFFAOYSA-N
MW150.14 g/mol
LogP0.61
Rot. Bonds1

About 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid

6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid (PubChem CID 130299224) has the molecular formula C7H6N2O2 and a molecular weight of 150.14 g/mol. Its IUPAC name is 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid.

Molecular Properties

Compound Name6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid
PubChem CID130299224
Molecular FormulaC7H6N2O2
Molecular Weight150.14 g/mol
Exact Mass150.04
IUPAC Name6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid
SMILESO=C(O)c1cc2n(n1)CC=C2
InChIInChI=1S/C7H6N2O2/c10-7(11)6-4-5-2-1-3-9(5)8-6/h1-2,4H,3H2,(H,10,11)
InChIKeyIATCEXDXRBSKDF-UHFFFAOYSA-N
XLogP0.61
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.14
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid?
The IUPAC name of 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid (CID 130299224) is 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid.
What is the SMILES notation for 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid?
The canonical SMILES for 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid is O=C(O)c1cc2n(n1)CC=C2.
What is the InChIKey of 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid?
The InChIKey is IATCEXDXRBSKDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c10-7(11)6-4-5-2-1-3-9(5)8-6/h1-2,4H,3H2,(H,10,11).
What are the key properties of 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid?
6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid has a molecular weight of 150.14 g/mol, XLogP of 0.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrrolo[2,1-e]pyrazole-2-carboxylic acid is sourced from PubChem (CID 130299224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).