C5H4N2O4S — CID 20573952
1-sulfanylpyrazole-3,5-dicarboxylic acid (PubChem CID 20573952) has the molecular formula C5H4N2O4S and a molecular weight of 188.16 g/mol. Its IUPAC name is 1-sulfanylpyrazole-3,5-dicarboxylic acid.
| Compound Name | 1-sulfanylpyrazole-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 20573952 |
| Molecular Formula | C5H4N2O4S |
| Molecular Weight | 188.16 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | 1-sulfanylpyrazole-3,5-dicarboxylic acid |
| SMILES | O=C(O)c1cc(C(=O)O)n(S)n1 |
| InChI | InChI=1S/C5H4N2O4S/c8-4(9)2-1-3(5(10)11)7(12)6-2/h1,12H,(H,8,9)(H,10,11) |
| InChIKey | ARUMFLFGPNJMDQ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.16 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|