About 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid
3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid (PubChem CID 95732990) has the molecular formula C7H6N2O3
and a molecular weight of 166.14 g/mol. Its IUPAC name is 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid.
Analyze 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid?
The IUPAC name of 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid (CID 95732990) is 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid.
What is the SMILES notation for 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid?
The canonical SMILES for 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid is Cc1coc2cc(C(=O)O)nn12.
What is the InChIKey of 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid?
The InChIKey is HPHDFVAHJRWLEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O3/c1-4-3-12-6-2-5(7(10)11)8-9(4)6/h2-3H,1H3,(H,10,11).
What are the key properties of 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid?
3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid has a molecular weight of 166.14 g/mol, XLogP of 0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpyrazolo[5,1-b][1,3]oxazole-6-carboxylic acid is sourced from PubChem (CID 95732990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).