C22H20N4O2 — CID 130303053
2-[2-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethyl]isoindole-1,3-dione (PubChem CID 130303053) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-[2-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 130303053 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-[2-[4-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl)phenyl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1ccc(N2CCn3ccnc3C2)cc1 |
| InChI | InChI=1S/C22H20N4O2/c27-21-18-3-1-2-4-19(18)22(28)26(21)11-9-16-5-7-17(8-6-16)25-14-13-24-12-10-23-20(24)15-25/h1-8,10,12H,9,11,13-15H2 |
| InChIKey | QTFJLVKLUXRLPT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|