C42H54N8O8 — CID 130305111
1-N,3-N-bis[4-[[3-(2-aminoethylcarbamoyl)benzoyl]amino]cyclohexyl]-4,6-dimethoxybenzene-1,3-dicarboxamide (PubChem CID 130305111) has the molecular formula C42H54N8O8 and a molecular weight of 798.94 g/mol. Its IUPAC name is 1-N,3-N-bis[4-[[3-(2-aminoethylcarbamoyl)benzoyl]amino]cyclohexyl]-4,6-dimethoxybenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-[[3-(2-aminoethylcarbamoyl)benzoyl]amino]cyclohexyl]-4,6-dimethoxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 130305111 |
| Molecular Formula | C42H54N8O8 |
| Molecular Weight | 798.94 g/mol |
| Exact Mass | 798.41 |
| IUPAC Name | 1-N,3-N-bis[4-[[3-(2-aminoethylcarbamoyl)benzoyl]amino]cyclohexyl]-4,6-dimethoxybenzene-1,3-dicarboxamide |
| SMILES | COc1cc(OC)c(C(=O)NC2CCC(NC(=O)c3cccc(C(=O)NCCN)c3)CC2)cc1C(=O)NC1CCC(NC(=O)c2cccc(C(=O)NCCN)c2)CC1 |
| InChI | InChI=1S/C42H54N8O8/c1-57-35-24-36(58-2)34(42(56)50-32-15-11-30(12-16-32)48-40(54)28-8-4-6-26(22-28)38(52)46-20-18-44)23-33(35)41(55)49-31-13-9-29(10-14-31)47-39(53)27-7-3-5-25(21-27)37(51)45-19-17-43/h3-8,21-24,29-32H,9-20,43-44H2,1-2H3,(H,45,51)(H,46,52)(H,47,53)(H,48,54)(H,49,55)(H,50,56) |
| InChIKey | GPQWGQONBLDNCH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 245.10 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.94 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |