C22H27NO5 — CID 130305120
2-(2,2-dimethylbutanoyloxy)ethyl (2E,4E)-2-cyano-5-[2-(hydroxymethyl)-5-methylphenyl]penta-2,4-dienoate (PubChem CID 130305120) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl (2E,4E)-2-cyano-5-[2-(hydroxymethyl)-5-methylphenyl]penta-2,4-dienoate.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl (2E,4E)-2-cyano-5-[2-(hydroxymethyl)-5-methylphenyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 130305120 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl (2E,4E)-2-cyano-5-[2-(hydroxymethyl)-5-methylphenyl]penta-2,4-dienoate |
| SMILES | CCC(C)(C)C(=O)OCCOC(=O)/C(C#N)=C/C=C/c1cc(C)ccc1CO |
| InChI | InChI=1S/C22H27NO5/c1-5-22(3,4)21(26)28-12-11-27-20(25)18(14-23)8-6-7-17-13-16(2)9-10-19(17)15-24/h6-10,13,24H,5,11-12,15H2,1-4H3/b7-6+,18-8+ |
| InChIKey | NZVSVTJELTUTMD-DSKQRQMOSA-N |
| XLogP | 3.47 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|