C16H25N3O5 — CID 13030882
N-[2-[[2-hydroxy-3-(2-nitrophenoxy)propyl]amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 13030882) has the molecular formula C16H25N3O5 and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[2-[[2-hydroxy-3-(2-nitrophenoxy)propyl]amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[[2-hydroxy-3-(2-nitrophenoxy)propyl]amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 13030882 |
| Molecular Formula | C16H25N3O5 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | N-[2-[[2-hydroxy-3-(2-nitrophenoxy)propyl]amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NCCNCC(O)COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H25N3O5/c1-16(2,3)15(21)18-9-8-17-10-12(20)11-24-14-7-5-4-6-13(14)19(22)23/h4-7,12,17,20H,8-11H2,1-3H3,(H,18,21) |
| InChIKey | IHHPMVSFCSHBFJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|