C13H18BrNO3 — CID 65014363
1-[2-(bromomethyl)-3,3-dimethylbutoxy]-2-nitrobenzene (PubChem CID 65014363) has the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutoxy]-2-nitrobenzene.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutoxy]-2-nitrobenzene |
|---|---|
| PubChem CID | 65014363 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutoxy]-2-nitrobenzene |
| SMILES | CC(C)(C)C(CBr)COc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18BrNO3/c1-13(2,3)10(8-14)9-18-12-7-5-4-6-11(12)15(16)17/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | VIHCSWYFFGRZQF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|