C39H46N2 — CID 130311185
(9R)-6,9,10,10-tetramethyl-5-[3-(6,10,10-trimethyl-6,7,8,9-tetrahydrocyclohepta[b]indol-5-yl)phenyl]-6,7,8,9-tetrahydrocyclohepta[b]indole (PubChem CID 130311185) has the molecular formula C39H46N2 and a molecular weight of 542.81 g/mol. Its IUPAC name is (9R)-6,9,10,10-tetramethyl-5-[3-(6,10,10-trimethyl-6,7,8,9-tetrahydrocyclohepta[b]indol-5-yl)phenyl]-6,7,8,9-tetrahydrocyclohepta[b]indole.
| Compound Name | (9R)-6,9,10,10-tetramethyl-5-[3-(6,10,10-trimethyl-6,7,8,9-tetrahydrocyclohepta[b]indol-5-yl)phenyl]-6,7,8,9-tetrahydrocyclohepta[b]indole |
|---|---|
| PubChem CID | 130311185 |
| Molecular Formula | C39H46N2 |
| Molecular Weight | 542.81 g/mol |
| Exact Mass | 542.37 |
| IUPAC Name | (9R)-6,9,10,10-tetramethyl-5-[3-(6,10,10-trimethyl-6,7,8,9-tetrahydrocyclohepta[b]indol-5-yl)phenyl]-6,7,8,9-tetrahydrocyclohepta[b]indole |
| SMILES | CC1CCCC(C)(C)c2c1n(-c1cccc(-n3c4c(c5ccccc53)C(C)(C)[C@H](C)CCC4C)c1)c1ccccc21 |
| InChI | InChI=1S/C39H46N2/c1-25-14-13-23-38(4,5)34-30-17-8-10-19-32(30)40(36(25)34)28-15-12-16-29(24-28)41-33-20-11-9-18-31(33)35-37(41)26(2)21-22-27(3)39(35,6)7/h8-12,15-20,24-27H,13-14,21-23H2,1-7H3/t25?,26?,27-/m1/s1 |
| InChIKey | BIYLKIOCZGJODO-WZDPVOGJSA-N |
| XLogP | 10.95 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.81 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |