C38H44N2 — CID 59227870
1,1,4,4-tetramethyl-9-[3-(1,1,4,4-tetramethyl-2,3-dihydrocarbazol-9-yl)phenyl]-2,3-dihydrocarbazole (PubChem CID 59227870) has the molecular formula C38H44N2 and a molecular weight of 528.78 g/mol. Its IUPAC name is 1,1,4,4-tetramethyl-9-[3-(1,1,4,4-tetramethyl-2,3-dihydrocarbazol-9-yl)phenyl]-2,3-dihydrocarbazole.
| Compound Name | 1,1,4,4-tetramethyl-9-[3-(1,1,4,4-tetramethyl-2,3-dihydrocarbazol-9-yl)phenyl]-2,3-dihydrocarbazole |
|---|---|
| PubChem CID | 59227870 |
| Molecular Formula | C38H44N2 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | 1,1,4,4-tetramethyl-9-[3-(1,1,4,4-tetramethyl-2,3-dihydrocarbazol-9-yl)phenyl]-2,3-dihydrocarbazole |
| SMILES | CC1(C)CCC(C)(C)c2c1c1ccccc1n2-c1cccc(-n2c3c(c4ccccc42)C(C)(C)CCC3(C)C)c1 |
| InChI | InChI=1S/C38H44N2/c1-35(2)20-22-37(5,6)33-31(35)27-16-9-11-18-29(27)39(33)25-14-13-15-26(24-25)40-30-19-12-10-17-28(30)32-34(40)38(7,8)23-21-36(32,3)4/h9-19,24H,20-23H2,1-8H3 |
| InChIKey | ZTYQIHFQSJQKMH-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |