C32H35FN4O4 — CID 130312221
3-[7-[(2E,3Z)-2-ethylidene-5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]hexa-3,5-dienoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 130312221) has the molecular formula C32H35FN4O4 and a molecular weight of 558.65 g/mol. Its IUPAC name is 3-[7-[(2E,3Z)-2-ethylidene-5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]hexa-3,5-dienoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[(2E,3Z)-2-ethylidene-5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]hexa-3,5-dienoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 130312221 |
| Molecular Formula | C32H35FN4O4 |
| Molecular Weight | 558.65 g/mol |
| Exact Mass | 558.26 |
| IUPAC Name | 3-[7-[(2E,3Z)-2-ethylidene-5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]hexa-3,5-dienoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C=C(/C=C\C(=C/C)COc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C32H35FN4O4/c1-3-23(8-7-22(2)19-35-15-17-36(18-16-35)25-11-9-24(33)10-12-25)21-41-29-6-4-5-26-27(29)20-37(32(26)40)28-13-14-30(38)34-31(28)39/h3-12,28H,2,13-21H2,1H3,(H,34,38,39)/b8-7-,23-3+ |
| InChIKey | VPDNYBOPZMNWSS-MWVWOVBWSA-N |
| XLogP | 3.85 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.65 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|