C8H12O3 — CID 13031345
2-methoxy-1,6-dioxaspiro[4.4]non-3-ene (PubChem CID 13031345) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-methoxy-1,6-dioxaspiro[4.4]non-3-ene.
| Compound Name | 2-methoxy-1,6-dioxaspiro[4.4]non-3-ene |
|---|---|
| PubChem CID | 13031345 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2-methoxy-1,6-dioxaspiro[4.4]non-3-ene |
| SMILES | COC1C=CC2(CCCO2)O1 |
| InChI | InChI=1S/C8H12O3/c1-9-7-3-5-8(11-7)4-2-6-10-8/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | UKMZYDSGJHVHMN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_misc_A(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|