C20H19N7O — CID 130313805
N-[3-[[6-[(2-methyl-2H-pyrrol-4-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enamide (PubChem CID 130313805) has the molecular formula C20H19N7O and a molecular weight of 373.42 g/mol. Its IUPAC name is N-[3-[[6-[(2-methyl-2H-pyrrol-4-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[6-[(2-methyl-2H-pyrrol-4-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 130313805 |
| Molecular Formula | C20H19N7O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-[3-[[6-[(2-methyl-2H-pyrrol-4-yl)amino]pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(Cn2ncc3cnc(NC4=CC(C)N=C4)nc32)c1 |
| InChI | InChI=1S/C20H19N7O/c1-3-18(28)24-16-6-4-5-14(8-16)12-27-19-15(10-23-27)9-22-20(26-19)25-17-7-13(2)21-11-17/h3-11,13H,1,12H2,2H3,(H,24,28)(H,22,25,26) |
| InChIKey | LOGISYYNBHURJY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 97.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|