C19H21N5O2 — CID 144952655
N-[3-[[5,5-dimethyl-2-(methylamino)-6-oxopyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]prop-2-enamide (PubChem CID 144952655) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[3-[[5,5-dimethyl-2-(methylamino)-6-oxopyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]prop-2-enamide.
| Compound Name | N-[3-[[5,5-dimethyl-2-(methylamino)-6-oxopyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 144952655 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[3-[[5,5-dimethyl-2-(methylamino)-6-oxopyrrolo[2,3-d]pyrimidin-7-yl]methyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cccc(CN2C(=O)C(C)(C)c3cnc(NC)nc32)c1 |
| InChI | InChI=1S/C19H21N5O2/c1-5-15(25)22-13-8-6-7-12(9-13)11-24-16-14(19(2,3)17(24)26)10-21-18(20-4)23-16/h5-10H,1,11H2,2-4H3,(H,22,25)(H,20,21,23) |
| InChIKey | ZOSXNVYOUYGJRD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|