C12H11F2NS — CID 130314674
5-[(2,4-difluorophenyl)methyl]-2-ethyl-1,3-thiazole (PubChem CID 130314674) has the molecular formula C12H11F2NS and a molecular weight of 239.29 g/mol. Its IUPAC name is 5-[(2,4-difluorophenyl)methyl]-2-ethyl-1,3-thiazole.
| Compound Name | 5-[(2,4-difluorophenyl)methyl]-2-ethyl-1,3-thiazole |
|---|---|
| PubChem CID | 130314674 |
| Molecular Formula | C12H11F2NS |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 5-[(2,4-difluorophenyl)methyl]-2-ethyl-1,3-thiazole |
| SMILES | CCc1ncc(Cc2ccc(F)cc2F)s1 |
| InChI | InChI=1S/C12H11F2NS/c1-2-12-15-7-10(16-12)5-8-3-4-9(13)6-11(8)14/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | DZGKMXGZBQFEPQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |