C11H10F2N2S — CID 126611875
2-[(2,5-difluorophenyl)methyl]-5-ethyl-1,3,4-thiadiazole (PubChem CID 126611875) has the molecular formula C11H10F2N2S and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-5-ethyl-1,3,4-thiadiazole.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-5-ethyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 126611875 |
| Molecular Formula | C11H10F2N2S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-5-ethyl-1,3,4-thiadiazole |
| SMILES | CCc1nnc(Cc2cc(F)ccc2F)s1 |
| InChI | InChI=1S/C11H10F2N2S/c1-2-10-14-15-11(16-10)6-7-5-8(12)3-4-9(7)13/h3-5H,2,6H2,1H3 |
| InChIKey | CEKBTAIVTSCSBA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |