C19H14F3N3O — CID 130315276
N-[1-(3-pyrimidin-5-ylphenyl)ethenyl]-4-(trifluoromethoxy)aniline (PubChem CID 130315276) has the molecular formula C19H14F3N3O and a molecular weight of 357.34 g/mol. Its IUPAC name is N-[1-(3-pyrimidin-5-ylphenyl)ethenyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-[1-(3-pyrimidin-5-ylphenyl)ethenyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 130315276 |
| Molecular Formula | C19H14F3N3O |
| Molecular Weight | 357.34 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N-[1-(3-pyrimidin-5-ylphenyl)ethenyl]-4-(trifluoromethoxy)aniline |
| SMILES | C=C(Nc1ccc(OC(F)(F)F)cc1)c1cccc(-c2cncnc2)c1 |
| InChI | InChI=1S/C19H14F3N3O/c1-13(25-17-5-7-18(8-6-17)26-19(20,21)22)14-3-2-4-15(9-14)16-10-23-12-24-11-16/h2-12,25H,1H2 |
| InChIKey | DQJNDLWHGQXJCA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.34 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |