C10H21NO2 — CID 130315419
cis-(1R,3R)-3-(hydroperoxymethyl)-1,2,2,3-tetramethylcyclopentan-1-amine (PubChem CID 130315419) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is cis-(1R,3R)-3-(hydroperoxymethyl)-1,2,2,3-tetramethylcyclopentan-1-amine.
| Compound Name | cis-(1R,3R)-3-(hydroperoxymethyl)-1,2,2,3-tetramethylcyclopentan-1-amine |
|---|---|
| PubChem CID | 130315419 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | cis-(1R,3R)-3-(hydroperoxymethyl)-1,2,2,3-tetramethylcyclopentan-1-amine |
| SMILES | CC1(C)[C@](C)(COO)CC[C@@]1(C)N |
| InChI | InChI=1S/C10H21NO2/c1-8(2)9(3,7-13-12)5-6-10(8,4)11/h12H,5-7,11H2,1-4H3/t9-,10+/m0/s1 |
| InChIKey | NICRXOBNXXUZQL-VHSXEESVSA-N |
| XLogP | 2.02 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|