C28H34N8 — CID 130316502
6-[2-[[(4Z)-2,4-dimethylhepta-2,4-dien-6-yn-3-yl]amino]imidazol-1-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidin-4-amine (PubChem CID 130316502) has the molecular formula C28H34N8 and a molecular weight of 482.64 g/mol. Its IUPAC name is 6-[2-[[(4Z)-2,4-dimethylhepta-2,4-dien-6-yn-3-yl]amino]imidazol-1-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidin-4-amine.
| Compound Name | 6-[2-[[(4Z)-2,4-dimethylhepta-2,4-dien-6-yn-3-yl]amino]imidazol-1-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 130316502 |
| Molecular Formula | C28H34N8 |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 6-[2-[[(4Z)-2,4-dimethylhepta-2,4-dien-6-yn-3-yl]amino]imidazol-1-yl]-N-[4-(4-ethylpiperazin-1-yl)phenyl]pyrimidin-4-amine |
| SMILES | C#C/C=C(/C)C(Nc1nccn1-c1cc(Nc2ccc(N3CCN(CC)CC3)cc2)ncn1)=C(C)C |
| InChI | InChI=1S/C28H34N8/c1-6-8-22(5)27(21(3)4)33-28-29-13-14-36(28)26-19-25(30-20-31-26)32-23-9-11-24(12-10-23)35-17-15-34(7-2)16-18-35/h1,8-14,19-20H,7,15-18H2,2-5H3,(H,29,33)(H,30,31,32)/b22-8- |
| InChIKey | KBKFIRUBYGPNFG-UYOCIXKTSA-N |
| XLogP | 4.83 |
| TPSA | 74.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|