C16H16F3N3O4 — CID 130316983
(3S)-3-[[hydroxy-[5-(2,2,2-trifluoroethyl)-1,2-oxazol-3-yl]methyl]amino]-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 130316983) has the molecular formula C16H16F3N3O4 and a molecular weight of 371.32 g/mol. Its IUPAC name is (3S)-3-[[hydroxy-[5-(2,2,2-trifluoroethyl)-1,2-oxazol-3-yl]methyl]amino]-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one.
| Compound Name | (3S)-3-[[hydroxy-[5-(2,2,2-trifluoroethyl)-1,2-oxazol-3-yl]methyl]amino]-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 130316983 |
| Molecular Formula | C16H16F3N3O4 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (3S)-3-[[hydroxy-[5-(2,2,2-trifluoroethyl)-1,2-oxazol-3-yl]methyl]amino]-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CN1C(=O)[C@@H](NC(O)c2cc(CC(F)(F)F)on2)COc2ccccc21 |
| InChI | InChI=1S/C16H16F3N3O4/c1-22-12-4-2-3-5-13(12)25-8-11(15(22)24)20-14(23)10-6-9(26-21-10)7-16(17,18)19/h2-6,11,14,20,23H,7-8H2,1H3/t11-,14?/m0/s1 |
| InChIKey | FUHZWHKYQDDJAD-ZSOXZCCMSA-N |
| XLogP | 1.78 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|