C15H11N3S3 — CID 130317906
4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine (PubChem CID 130317906) has the molecular formula C15H11N3S3 and a molecular weight of 329.48 g/mol. Its IUPAC name is 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine.
| Compound Name | 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 130317906 |
| Molecular Formula | C15H11N3S3 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 4,7-bis(5-methylthiophen-2-yl)thiadiazolo[4,5-c]pyridine |
| SMILES | Cc1ccc(-c2ncc(-c3ccc(C)s3)c3snnc23)s1 |
| InChI | InChI=1S/C15H11N3S3/c1-8-3-5-11(19-8)10-7-16-13(12-6-4-9(2)20-12)14-15(10)21-18-17-14/h3-7H,1-2H3 |
| InChIKey | PKDCQQDJOZNYBD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |