C14H8I2 — CID 130319188
1,6-diiodoanthracene (PubChem CID 130319188) has the molecular formula C14H8I2 and a molecular weight of 430.03 g/mol. Its IUPAC name is 1,6-diiodoanthracene.
| Compound Name | 1,6-diiodoanthracene |
|---|---|
| PubChem CID | 130319188 |
| Molecular Formula | C14H8I2 |
| Molecular Weight | 430.03 g/mol |
| Exact Mass | 429.87 |
| IUPAC Name | 1,6-diiodoanthracene |
| SMILES | Ic1ccc2cc3c(I)cccc3cc2c1 |
| InChI | InChI=1S/C14H8I2/c15-12-5-4-9-8-13-10(6-11(9)7-12)2-1-3-14(13)16/h1-8H |
| InChIKey | XYSMOTJQEJVRFR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.03 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|