C14H11S+ — CID 23128637
anthracen-1-ylsulfanium (PubChem CID 23128637) has the molecular formula C14H11S+ and a molecular weight of 211.31 g/mol. Its IUPAC name is anthracen-1-ylsulfanium.
| Compound Name | anthracen-1-ylsulfanium |
|---|---|
| PubChem CID | 23128637 |
| Molecular Formula | C14H11S+ |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | anthracen-1-ylsulfanium |
| SMILES | [SH2+]c1cccc2cc3ccccc3cc12 |
| InChI | InChI=1S/C14H10S/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9,15H/p+1 |
| InChIKey | HCQYOADEQHBNDH-UHFFFAOYSA-O |
| XLogP | 3.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|