C18H11B — CID 174412764
CID 174412764 (PubChem CID 174412764) has the molecular formula C18H11B and a molecular weight of 238.10 g/mol.
| Compound Name | CID 174412764 |
|---|---|
| PubChem CID | 174412764 |
| Molecular Formula | C18H11B |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | — |
| SMILES | [B]c1cccc2cc3cc4ccccc4cc3cc12 |
| InChI | InChI=1S/C18H11B/c19-18-7-3-6-14-10-15-8-12-4-1-2-5-13(12)9-16(15)11-17(14)18/h1-11H |
| InChIKey | ZIKXRDDNKUKVAU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|