C17H18F4IN3O2 — CID 130323628
2-[5-fluoro-4-(iodomethyl)-2-oxospiro[indole-3,4'-piperidine]-1-yl]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 130323628) has the molecular formula C17H18F4IN3O2 and a molecular weight of 499.25 g/mol. Its IUPAC name is 2-[5-fluoro-4-(iodomethyl)-2-oxospiro[indole-3,4'-piperidine]-1-yl]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[5-fluoro-4-(iodomethyl)-2-oxospiro[indole-3,4'-piperidine]-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 130323628 |
| Molecular Formula | C17H18F4IN3O2 |
| Molecular Weight | 499.25 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 2-[5-fluoro-4-(iodomethyl)-2-oxospiro[indole-3,4'-piperidine]-1-yl]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(CN1C(=O)C2(CCNCC2)c2c1ccc(F)c2CI)NCC(F)(F)F |
| InChI | InChI=1S/C17H18F4IN3O2/c18-11-1-2-12-14(10(11)7-22)16(3-5-23-6-4-16)15(27)25(12)8-13(26)24-9-17(19,20)21/h1-2,23H,3-9H2,(H,24,26) |
| InChIKey | JJWAZWMKHRDCEJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|