C15H17BrN2O3 — CID 130323698
methyl 2-(4-bromo-2-oxospiro[indole-3,4'-piperidine]-1-yl)acetate (PubChem CID 130323698) has the molecular formula C15H17BrN2O3 and a molecular weight of 353.22 g/mol. Its IUPAC name is methyl 2-(4-bromo-2-oxospiro[indole-3,4'-piperidine]-1-yl)acetate.
| Compound Name | methyl 2-(4-bromo-2-oxospiro[indole-3,4'-piperidine]-1-yl)acetate |
|---|---|
| PubChem CID | 130323698 |
| Molecular Formula | C15H17BrN2O3 |
| Molecular Weight | 353.22 g/mol |
| Exact Mass | 352.04 |
| IUPAC Name | methyl 2-(4-bromo-2-oxospiro[indole-3,4'-piperidine]-1-yl)acetate |
| SMILES | COC(=O)CN1C(=O)C2(CCNCC2)c2c(Br)cccc21 |
| InChI | InChI=1S/C15H17BrN2O3/c1-21-12(19)9-18-11-4-2-3-10(16)13(11)15(14(18)20)5-7-17-8-6-15/h2-4,17H,5-9H2,1H3 |
| InChIKey | AUSCVXBDMYEDLF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |