C16H18F5N3O2 — CID 130323701
4,5-difluoro-1-[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethyl]spiro[indole-3,4'-piperidine]-2-one (PubChem CID 130323701) has the molecular formula C16H18F5N3O2 and a molecular weight of 379.33 g/mol. Its IUPAC name is 4,5-difluoro-1-[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethyl]spiro[indole-3,4'-piperidine]-2-one.
| Compound Name | 4,5-difluoro-1-[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethyl]spiro[indole-3,4'-piperidine]-2-one |
|---|---|
| PubChem CID | 130323701 |
| Molecular Formula | C16H18F5N3O2 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 4,5-difluoro-1-[2-hydroxy-2-(2,2,2-trifluoroethylamino)ethyl]spiro[indole-3,4'-piperidine]-2-one |
| SMILES | O=C1N(CC(O)NCC(F)(F)F)c2ccc(F)c(F)c2C12CCNCC2 |
| InChI | InChI=1S/C16H18F5N3O2/c17-9-1-2-10-12(13(9)18)15(3-5-22-6-4-15)14(26)24(10)7-11(25)23-8-16(19,20)21/h1-2,11,22-23,25H,3-8H2 |
| InChIKey | NSLLTPLHGINLMF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|