C18H16F2N2O4S — CID 130323769
2,5-difluoro-4-[[4-[(1-methoxycyclopropanecarbonyl)amino]phenyl]sulfanylamino]benzoic acid (PubChem CID 130323769) has the molecular formula C18H16F2N2O4S and a molecular weight of 394.40 g/mol. Its IUPAC name is 2,5-difluoro-4-[[4-[(1-methoxycyclopropanecarbonyl)amino]phenyl]sulfanylamino]benzoic acid.
| Compound Name | 2,5-difluoro-4-[[4-[(1-methoxycyclopropanecarbonyl)amino]phenyl]sulfanylamino]benzoic acid |
|---|---|
| PubChem CID | 130323769 |
| Molecular Formula | C18H16F2N2O4S |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | 2,5-difluoro-4-[[4-[(1-methoxycyclopropanecarbonyl)amino]phenyl]sulfanylamino]benzoic acid |
| SMILES | COC1(C(=O)Nc2ccc(SNc3cc(F)c(C(=O)O)cc3F)cc2)CC1 |
| InChI | InChI=1S/C18H16F2N2O4S/c1-26-18(6-7-18)17(25)21-10-2-4-11(5-3-10)27-22-15-9-13(19)12(16(23)24)8-14(15)20/h2-5,8-9,22H,6-7H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | RGYHFFYJQACRPA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|