C19H20F2N2O3S — CID 130340531
4-[[4-(tert-butylcarbamoyl)-3-methylphenyl]sulfanylamino]-2,5-difluorobenzoic acid (PubChem CID 130340531) has the molecular formula C19H20F2N2O3S and a molecular weight of 394.44 g/mol. Its IUPAC name is 4-[[4-(tert-butylcarbamoyl)-3-methylphenyl]sulfanylamino]-2,5-difluorobenzoic acid.
| Compound Name | 4-[[4-(tert-butylcarbamoyl)-3-methylphenyl]sulfanylamino]-2,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 130340531 |
| Molecular Formula | C19H20F2N2O3S |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 4-[[4-(tert-butylcarbamoyl)-3-methylphenyl]sulfanylamino]-2,5-difluorobenzoic acid |
| SMILES | Cc1cc(SNc2cc(F)c(C(=O)O)cc2F)ccc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H20F2N2O3S/c1-10-7-11(5-6-12(10)17(24)22-19(2,3)4)27-23-16-9-14(20)13(18(25)26)8-15(16)21/h5-9,23H,1-4H3,(H,22,24)(H,25,26) |
| InChIKey | VTEDWQJJNHLJHY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|