C17H18F2N4O2S — CID 170203388
4-[[4-[amino-[(Z)-2-aminobut-1-enyl]amino]phenyl]sulfanylamino]-2,5-difluorobenzoic acid (PubChem CID 170203388) has the molecular formula C17H18F2N4O2S and a molecular weight of 380.42 g/mol. Its IUPAC name is 4-[[4-[amino-[(Z)-2-aminobut-1-enyl]amino]phenyl]sulfanylamino]-2,5-difluorobenzoic acid.
| Compound Name | 4-[[4-[amino-[(Z)-2-aminobut-1-enyl]amino]phenyl]sulfanylamino]-2,5-difluorobenzoic acid |
|---|---|
| PubChem CID | 170203388 |
| Molecular Formula | C17H18F2N4O2S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-[[4-[amino-[(Z)-2-aminobut-1-enyl]amino]phenyl]sulfanylamino]-2,5-difluorobenzoic acid |
| SMILES | CC/C(N)=C/N(N)c1ccc(SNc2cc(F)c(C(=O)O)cc2F)cc1 |
| InChI | InChI=1S/C17H18F2N4O2S/c1-2-10(20)9-23(21)11-3-5-12(6-4-11)26-22-16-8-14(18)13(17(24)25)7-15(16)19/h3-9,22H,2,20-21H2,1H3,(H,24,25)/b10-9- |
| InChIKey | GUUPDBKRSIFUER-KTKRTIGZSA-N |
| XLogP | 3.67 |
| TPSA | 104.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|