C17H16F2N4O4S — CID 163916166
2,5-difluoro-4-[[4-(2-hydrazinylidenebutylideneamino)phenyl]sulfonylamino]benzoic acid (PubChem CID 163916166) has the molecular formula C17H16F2N4O4S and a molecular weight of 410.40 g/mol. Its IUPAC name is 2,5-difluoro-4-[[4-(2-hydrazinylidenebutylideneamino)phenyl]sulfonylamino]benzoic acid.
| Compound Name | 2,5-difluoro-4-[[4-(2-hydrazinylidenebutylideneamino)phenyl]sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 163916166 |
| Molecular Formula | C17H16F2N4O4S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 2,5-difluoro-4-[[4-(2-hydrazinylidenebutylideneamino)phenyl]sulfonylamino]benzoic acid |
| SMILES | CCC(/C=N/c1ccc(S(=O)(=O)Nc2cc(F)c(C(=O)O)cc2F)cc1)=NN |
| InChI | InChI=1S/C17H16F2N4O4S/c1-2-10(22-20)9-21-11-3-5-12(6-4-11)28(26,27)23-16-8-14(18)13(17(24)25)7-15(16)19/h3-9,23H,2,20H2,1H3,(H,24,25)/b21-9+,22-10? |
| InChIKey | MYFBLUDCQPIRFB-OTNSYEHCSA-N |
| XLogP | 2.89 |
| TPSA | 134.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|